C19H18FNO5 — CID 99874961
methyl (2R,4R)-4-(2-fluorophenoxy)-1-[(E)-3-(furan-2-yl)prop-2-enoyl]pyrrolidine-2-carboxylate (PubChem CID 99874961) has the molecular formula C19H18FNO5 and a molecular weight of 359.35 g/mol. Its IUPAC name is methyl (2R,4R)-4-(2-fluorophenoxy)-1-[(E)-3-(furan-2-yl)prop-2-enoyl]pyrrolidine-2-carboxylate.
| Compound Name | methyl (2R,4R)-4-(2-fluorophenoxy)-1-[(E)-3-(furan-2-yl)prop-2-enoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 99874961 |
| Molecular Formula | C19H18FNO5 |
| Molecular Weight | 359.35 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | methyl (2R,4R)-4-(2-fluorophenoxy)-1-[(E)-3-(furan-2-yl)prop-2-enoyl]pyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@H]1C[C@@H](Oc2ccccc2F)CN1C(=O)/C=C/c1ccco1 |
| InChI | InChI=1S/C19H18FNO5/c1-24-19(23)16-11-14(26-17-7-3-2-6-15(17)20)12-21(16)18(22)9-8-13-5-4-10-25-13/h2-10,14,16H,11-12H2,1H3/b9-8+/t14-,16-/m1/s1 |
| InChIKey | VJTJGHQBYYBJJW-MOIGAOQCSA-N |
| XLogP | 2.65 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.35 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|