C15H20FNO5S — CID 90620378
methyl 4-(2-fluorophenoxy)-1-propan-2-ylsulfonylpyrrolidine-2-carboxylate (PubChem CID 90620378) has the molecular formula C15H20FNO5S and a molecular weight of 345.39 g/mol. Its IUPAC name is methyl 4-(2-fluorophenoxy)-1-propan-2-ylsulfonylpyrrolidine-2-carboxylate.
| Compound Name | methyl 4-(2-fluorophenoxy)-1-propan-2-ylsulfonylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 90620378 |
| Molecular Formula | C15H20FNO5S |
| Molecular Weight | 345.39 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | methyl 4-(2-fluorophenoxy)-1-propan-2-ylsulfonylpyrrolidine-2-carboxylate |
| SMILES | COC(=O)C1CC(Oc2ccccc2F)CN1S(=O)(=O)C(C)C |
| InChI | InChI=1S/C15H20FNO5S/c1-10(2)23(19,20)17-9-11(8-13(17)15(18)21-3)22-14-7-5-4-6-12(14)16/h4-7,10-11,13H,8-9H2,1-3H3 |
| InChIKey | PGBBSDTZSAQKRE-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.39 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |