C25H24FNO5S — CID 90620477
methyl 4-(2-fluorophenoxy)-1-[4-(3-methylphenyl)phenyl]sulfonylpyrrolidine-2-carboxylate (PubChem CID 90620477) has the molecular formula C25H24FNO5S and a molecular weight of 469.53 g/mol. Its IUPAC name is methyl 4-(2-fluorophenoxy)-1-[4-(3-methylphenyl)phenyl]sulfonylpyrrolidine-2-carboxylate.
| Compound Name | methyl 4-(2-fluorophenoxy)-1-[4-(3-methylphenyl)phenyl]sulfonylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 90620477 |
| Molecular Formula | C25H24FNO5S |
| Molecular Weight | 469.53 g/mol |
| Exact Mass | 469.14 |
| IUPAC Name | methyl 4-(2-fluorophenoxy)-1-[4-(3-methylphenyl)phenyl]sulfonylpyrrolidine-2-carboxylate |
| SMILES | COC(=O)C1CC(Oc2ccccc2F)CN1S(=O)(=O)c1ccc(-c2cccc(C)c2)cc1 |
| InChI | InChI=1S/C25H24FNO5S/c1-17-6-5-7-19(14-17)18-10-12-21(13-11-18)33(29,30)27-16-20(15-23(27)25(28)31-2)32-24-9-4-3-8-22(24)26/h3-14,20,23H,15-16H2,1-2H3 |
| InChIKey | VWZGJBATLFJETH-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.53 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |