C24H22FNO5S — CID 90620484
methyl 4-(2-fluorophenoxy)-1-(3-phenylphenyl)sulfonylpyrrolidine-2-carboxylate (PubChem CID 90620484) has the molecular formula C24H22FNO5S and a molecular weight of 455.51 g/mol. Its IUPAC name is methyl 4-(2-fluorophenoxy)-1-(3-phenylphenyl)sulfonylpyrrolidine-2-carboxylate.
| Compound Name | methyl 4-(2-fluorophenoxy)-1-(3-phenylphenyl)sulfonylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 90620484 |
| Molecular Formula | C24H22FNO5S |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | methyl 4-(2-fluorophenoxy)-1-(3-phenylphenyl)sulfonylpyrrolidine-2-carboxylate |
| SMILES | COC(=O)C1CC(Oc2ccccc2F)CN1S(=O)(=O)c1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C24H22FNO5S/c1-30-24(27)22-15-19(31-23-13-6-5-12-21(23)25)16-26(22)32(28,29)20-11-7-10-18(14-20)17-8-3-2-4-9-17/h2-14,19,22H,15-16H2,1H3 |
| InChIKey | MBSAZWKYZULFOE-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |