C19H22N4OS — CID 90620539
2-benzylsulfanyl-N-[3-(2-methylpyrazolo[1,5-a]pyrimidin-6-yl)propyl]acetamide (PubChem CID 90620539) has the molecular formula C19H22N4OS and a molecular weight of 354.48 g/mol. Its IUPAC name is 2-benzylsulfanyl-N-[3-(2-methylpyrazolo[1,5-a]pyrimidin-6-yl)propyl]acetamide.
| Compound Name | 2-benzylsulfanyl-N-[3-(2-methylpyrazolo[1,5-a]pyrimidin-6-yl)propyl]acetamide |
|---|---|
| PubChem CID | 90620539 |
| Molecular Formula | C19H22N4OS |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 2-benzylsulfanyl-N-[3-(2-methylpyrazolo[1,5-a]pyrimidin-6-yl)propyl]acetamide |
| SMILES | Cc1cc2ncc(CCCNC(=O)CSCc3ccccc3)cn2n1 |
| InChI | InChI=1S/C19H22N4OS/c1-15-10-18-21-11-17(12-23(18)22-15)8-5-9-20-19(24)14-25-13-16-6-3-2-4-7-16/h2-4,6-7,10-12H,5,8-9,13-14H2,1H3,(H,20,24) |
| InChIKey | QNNVOMBBSZEEHA-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|