C19H21N5O3 — CID 90620614
N-[3-(2-methylpyrazolo[1,5-a]pyrimidin-6-yl)propyl]-3-(4-nitrophenyl)propanamide (PubChem CID 90620614) has the molecular formula C19H21N5O3 and a molecular weight of 367.41 g/mol. Its IUPAC name is N-[3-(2-methylpyrazolo[1,5-a]pyrimidin-6-yl)propyl]-3-(4-nitrophenyl)propanamide.
| Compound Name | N-[3-(2-methylpyrazolo[1,5-a]pyrimidin-6-yl)propyl]-3-(4-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 90620614 |
| Molecular Formula | C19H21N5O3 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | N-[3-(2-methylpyrazolo[1,5-a]pyrimidin-6-yl)propyl]-3-(4-nitrophenyl)propanamide |
| SMILES | Cc1cc2ncc(CCCNC(=O)CCc3ccc([N+](=O)[O-])cc3)cn2n1 |
| InChI | InChI=1S/C19H21N5O3/c1-14-11-18-21-12-16(13-23(18)22-14)3-2-10-20-19(25)9-6-15-4-7-17(8-5-15)24(26)27/h4-5,7-8,11-13H,2-3,6,9-10H2,1H3,(H,20,25) |
| InChIKey | FLRGGJAAUXZLRR-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 102.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|