C20H21N5OS — CID 90620616
2-ethyl-N-[3-(2-methylpyrazolo[1,5-a]pyrimidin-6-yl)propyl]-1,3-benzothiazole-6-carboxamide (PubChem CID 90620616) has the molecular formula C20H21N5OS and a molecular weight of 379.49 g/mol. Its IUPAC name is 2-ethyl-N-[3-(2-methylpyrazolo[1,5-a]pyrimidin-6-yl)propyl]-1,3-benzothiazole-6-carboxamide.
| Compound Name | 2-ethyl-N-[3-(2-methylpyrazolo[1,5-a]pyrimidin-6-yl)propyl]-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 90620616 |
| Molecular Formula | C20H21N5OS |
| Molecular Weight | 379.49 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 2-ethyl-N-[3-(2-methylpyrazolo[1,5-a]pyrimidin-6-yl)propyl]-1,3-benzothiazole-6-carboxamide |
| SMILES | CCc1nc2ccc(C(=O)NCCCc3cnc4cc(C)nn4c3)cc2s1 |
| InChI | InChI=1S/C20H21N5OS/c1-3-19-23-16-7-6-15(10-17(16)27-19)20(26)21-8-4-5-14-11-22-18-9-13(2)24-25(18)12-14/h6-7,9-12H,3-5,8H2,1-2H3,(H,21,26) |
| InChIKey | KHVWMPNXBAAQHD-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.49 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|