C20H22FN5O2 — CID 90622240
3-(4-fluorophenyl)-1-methyl-N-[1-(oxan-4-ylmethyl)pyrazol-4-yl]pyrazole-5-carboxamide (PubChem CID 90622240) has the molecular formula C20H22FN5O2 and a molecular weight of 383.43 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-1-methyl-N-[1-(oxan-4-ylmethyl)pyrazol-4-yl]pyrazole-5-carboxamide.
| Compound Name | 3-(4-fluorophenyl)-1-methyl-N-[1-(oxan-4-ylmethyl)pyrazol-4-yl]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 90622240 |
| Molecular Formula | C20H22FN5O2 |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | 3-(4-fluorophenyl)-1-methyl-N-[1-(oxan-4-ylmethyl)pyrazol-4-yl]pyrazole-5-carboxamide |
| SMILES | Cn1nc(-c2ccc(F)cc2)cc1C(=O)Nc1cnn(CC2CCOCC2)c1 |
| InChI | InChI=1S/C20H22FN5O2/c1-25-19(10-18(24-25)15-2-4-16(21)5-3-15)20(27)23-17-11-22-26(13-17)12-14-6-8-28-9-7-14/h2-5,10-11,13-14H,6-9,12H2,1H3,(H,23,27) |
| InChIKey | CMUUCQGPCIJKHU-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 73.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |