C16H20N4O4 — CID 90622776
1-[1-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)pyrazol-4-yl]-3-(2-methoxyethyl)urea (PubChem CID 90622776) has the molecular formula C16H20N4O4 and a molecular weight of 332.36 g/mol. Its IUPAC name is 1-[1-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)pyrazol-4-yl]-3-(2-methoxyethyl)urea.
| Compound Name | 1-[1-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)pyrazol-4-yl]-3-(2-methoxyethyl)urea |
|---|---|
| PubChem CID | 90622776 |
| Molecular Formula | C16H20N4O4 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | 1-[1-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)pyrazol-4-yl]-3-(2-methoxyethyl)urea |
| SMILES | COCCNC(=O)Nc1cnn(CC2COc3ccccc3O2)c1 |
| InChI | InChI=1S/C16H20N4O4/c1-22-7-6-17-16(21)19-12-8-18-20(9-12)10-13-11-23-14-4-2-3-5-15(14)24-13/h2-5,8-9,13H,6-7,10-11H2,1H3,(H2,17,19,21) |
| InChIKey | VBGLJFRTFBVKGQ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 86.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|