C20H26FNO2 — CID 90622955
N-[2-(3-fluorophenyl)-2-methoxyethyl]adamantane-1-carboxamide (PubChem CID 90622955) has the molecular formula C20H26FNO2 and a molecular weight of 331.43 g/mol. Its IUPAC name is N-[2-(3-fluorophenyl)-2-methoxyethyl]adamantane-1-carboxamide.
| Compound Name | N-[2-(3-fluorophenyl)-2-methoxyethyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 90622955 |
| Molecular Formula | C20H26FNO2 |
| Molecular Weight | 331.43 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | N-[2-(3-fluorophenyl)-2-methoxyethyl]adamantane-1-carboxamide |
| SMILES | COC(CNC(=O)C12CC3CC(CC(C3)C1)C2)c1cccc(F)c1 |
| InChI | InChI=1S/C20H26FNO2/c1-24-18(16-3-2-4-17(21)8-16)12-22-19(23)20-9-13-5-14(10-20)7-15(6-13)11-20/h2-4,8,13-15,18H,5-7,9-12H2,1H3,(H,22,23) |
| InChIKey | SOYFGFSVWNZNHH-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.43 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |