C19H23F2NO2 — CID 42959545
N-[2-(3,4-difluorophenyl)-2-hydroxyethyl]adamantane-1-carboxamide (PubChem CID 42959545) has the molecular formula C19H23F2NO2 and a molecular weight of 335.39 g/mol. Its IUPAC name is N-[2-(3,4-difluorophenyl)-2-hydroxyethyl]adamantane-1-carboxamide.
| Compound Name | N-[2-(3,4-difluorophenyl)-2-hydroxyethyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 42959545 |
| Molecular Formula | C19H23F2NO2 |
| Molecular Weight | 335.39 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | N-[2-(3,4-difluorophenyl)-2-hydroxyethyl]adamantane-1-carboxamide |
| SMILES | O=C(NCC(O)c1ccc(F)c(F)c1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C19H23F2NO2/c20-15-2-1-14(6-16(15)21)17(23)10-22-18(24)19-7-11-3-12(8-19)5-13(4-11)9-19/h1-2,6,11-13,17,23H,3-5,7-10H2,(H,22,24) |
| InChIKey | LNTKSVPMBULQMP-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.39 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |