C18H31N3O3 — CID 90624346
N-[2-(dimethylamino)ethyl]-N'-[(2-methoxy-2-adamantyl)methyl]oxamide (PubChem CID 90624346) has the molecular formula C18H31N3O3 and a molecular weight of 337.46 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-N'-[(2-methoxy-2-adamantyl)methyl]oxamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-N'-[(2-methoxy-2-adamantyl)methyl]oxamide |
|---|---|
| PubChem CID | 90624346 |
| Molecular Formula | C18H31N3O3 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.24 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-N'-[(2-methoxy-2-adamantyl)methyl]oxamide |
| SMILES | COC1(CNC(=O)C(=O)NCCN(C)C)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C18H31N3O3/c1-21(2)5-4-19-16(22)17(23)20-11-18(24-3)14-7-12-6-13(9-14)10-15(18)8-12/h12-15H,4-11H2,1-3H3,(H,19,22)(H,20,23) |
| InChIKey | UMEUGUFUEPZKHR-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|