C10H13ClN2O3 — CID 90624843
2-chloro-N-[2-hydroxy-3-(2-oxo-1-pyridinyl)propyl]acetamide (PubChem CID 90624843) has the molecular formula C10H13ClN2O3 and a molecular weight of 244.68 g/mol. Its IUPAC name is 2-chloro-N-[2-hydroxy-3-(2-oxo-1-pyridinyl)propyl]acetamide.
| Compound Name | 2-chloro-N-[2-hydroxy-3-(2-oxo-1-pyridinyl)propyl]acetamide |
|---|---|
| PubChem CID | 90624843 |
| Molecular Formula | C10H13ClN2O3 |
| Molecular Weight | 244.68 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | 2-chloro-N-[2-hydroxy-3-(2-oxo-1-pyridinyl)propyl]acetamide |
| SMILES | O=C(CCl)NCC(O)Cn1ccccc1=O |
| InChI | InChI=1S/C10H13ClN2O3/c11-5-9(15)12-6-8(14)7-13-4-2-1-3-10(13)16/h1-4,8,14H,5-7H2,(H,12,15) |
| InChIKey | SKCMAYXCRDMQCG-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.68 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|