C18H23N3O3 — CID 90625123
1-[2-hydroxy-3-(2-oxo-1-pyridinyl)propyl]-3-(3-phenylpropyl)urea (PubChem CID 90625123) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is 1-[2-hydroxy-3-(2-oxo-1-pyridinyl)propyl]-3-(3-phenylpropyl)urea.
| Compound Name | 1-[2-hydroxy-3-(2-oxo-1-pyridinyl)propyl]-3-(3-phenylpropyl)urea |
|---|---|
| PubChem CID | 90625123 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | 1-[2-hydroxy-3-(2-oxo-1-pyridinyl)propyl]-3-(3-phenylpropyl)urea |
| SMILES | O=C(NCCCc1ccccc1)NCC(O)Cn1ccccc1=O |
| InChI | InChI=1S/C18H23N3O3/c22-16(14-21-12-5-4-10-17(21)23)13-20-18(24)19-11-6-9-15-7-2-1-3-8-15/h1-5,7-8,10,12,16,22H,6,9,11,13-14H2,(H2,19,20,24) |
| InChIKey | ZBTSXQKXYQJAFB-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|