C15H13N3O4S — CID 90625337
N-(4-oxo-5,6,7,8-tetrahydro-[1,3]thiazolo[5,4-c]azepin-2-yl)-1,3-benzodioxole-5-carboxamide (PubChem CID 90625337) has the molecular formula C15H13N3O4S and a molecular weight of 331.35 g/mol. Its IUPAC name is N-(4-oxo-5,6,7,8-tetrahydro-[1,3]thiazolo[5,4-c]azepin-2-yl)-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-(4-oxo-5,6,7,8-tetrahydro-[1,3]thiazolo[5,4-c]azepin-2-yl)-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 90625337 |
| Molecular Formula | C15H13N3O4S |
| Molecular Weight | 331.35 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | N-(4-oxo-5,6,7,8-tetrahydro-[1,3]thiazolo[5,4-c]azepin-2-yl)-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(Nc1nc2c(s1)C(=O)NCCC2)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H13N3O4S/c19-13(8-3-4-10-11(6-8)22-7-21-10)18-15-17-9-2-1-5-16-14(20)12(9)23-15/h3-4,6H,1-2,5,7H2,(H,16,20)(H,17,18,19) |
| InChIKey | YWRWHGJGTGAYQV-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.35 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |