C14H12N4O4S — CID 90625358
4-nitro-N-(4-oxo-5,6,7,8-tetrahydro-[1,3]thiazolo[5,4-c]azepin-2-yl)benzamide (PubChem CID 90625358) has the molecular formula C14H12N4O4S and a molecular weight of 332.34 g/mol. Its IUPAC name is 4-nitro-N-(4-oxo-5,6,7,8-tetrahydro-[1,3]thiazolo[5,4-c]azepin-2-yl)benzamide.
| Compound Name | 4-nitro-N-(4-oxo-5,6,7,8-tetrahydro-[1,3]thiazolo[5,4-c]azepin-2-yl)benzamide |
|---|---|
| PubChem CID | 90625358 |
| Molecular Formula | C14H12N4O4S |
| Molecular Weight | 332.34 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | 4-nitro-N-(4-oxo-5,6,7,8-tetrahydro-[1,3]thiazolo[5,4-c]azepin-2-yl)benzamide |
| SMILES | O=C(Nc1nc2c(s1)C(=O)NCCC2)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H12N4O4S/c19-12(8-3-5-9(6-4-8)18(21)22)17-14-16-10-2-1-7-15-13(20)11(10)23-14/h3-6H,1-2,7H2,(H,15,20)(H,16,17,19) |
| InChIKey | UFARWNXSNTZEEP-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 114.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.34 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|