C14H11ClN4O4S — CID 90625361
5-chloro-2-nitro-N-(4-oxo-5,6,7,8-tetrahydro-[1,3]thiazolo[5,4-c]azepin-2-yl)benzamide (PubChem CID 90625361) has the molecular formula C14H11ClN4O4S and a molecular weight of 366.79 g/mol. Its IUPAC name is 5-chloro-2-nitro-N-(4-oxo-5,6,7,8-tetrahydro-[1,3]thiazolo[5,4-c]azepin-2-yl)benzamide.
| Compound Name | 5-chloro-2-nitro-N-(4-oxo-5,6,7,8-tetrahydro-[1,3]thiazolo[5,4-c]azepin-2-yl)benzamide |
|---|---|
| PubChem CID | 90625361 |
| Molecular Formula | C14H11ClN4O4S |
| Molecular Weight | 366.79 g/mol |
| Exact Mass | 366.02 |
| IUPAC Name | 5-chloro-2-nitro-N-(4-oxo-5,6,7,8-tetrahydro-[1,3]thiazolo[5,4-c]azepin-2-yl)benzamide |
| SMILES | O=C(Nc1nc2c(s1)C(=O)NCCC2)c1cc(Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H11ClN4O4S/c15-7-3-4-10(19(22)23)8(6-7)12(20)18-14-17-9-2-1-5-16-13(21)11(9)24-14/h3-4,6H,1-2,5H2,(H,16,21)(H,17,18,20) |
| InChIKey | KZCYXWQLZSOYJK-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 114.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.79 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|