C18H15N3O5S — CID 90625463
8-methoxy-2-oxo-N-(4-oxo-5,6,7,8-tetrahydro-[1,3]thiazolo[5,4-c]azepin-2-yl)chromene-3-carboxamide (PubChem CID 90625463) has the molecular formula C18H15N3O5S and a molecular weight of 385.40 g/mol. Its IUPAC name is 8-methoxy-2-oxo-N-(4-oxo-5,6,7,8-tetrahydro-[1,3]thiazolo[5,4-c]azepin-2-yl)chromene-3-carboxamide.
| Compound Name | 8-methoxy-2-oxo-N-(4-oxo-5,6,7,8-tetrahydro-[1,3]thiazolo[5,4-c]azepin-2-yl)chromene-3-carboxamide |
|---|---|
| PubChem CID | 90625463 |
| Molecular Formula | C18H15N3O5S |
| Molecular Weight | 385.40 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | 8-methoxy-2-oxo-N-(4-oxo-5,6,7,8-tetrahydro-[1,3]thiazolo[5,4-c]azepin-2-yl)chromene-3-carboxamide |
| SMILES | COc1cccc2cc(C(=O)Nc3nc4c(s3)C(=O)NCCC4)c(=O)oc12 |
| InChI | InChI=1S/C18H15N3O5S/c1-25-12-6-2-4-9-8-10(17(24)26-13(9)12)15(22)21-18-20-11-5-3-7-19-16(23)14(11)27-18/h2,4,6,8H,3,5,7H2,1H3,(H,19,23)(H,20,21,22) |
| InChIKey | KCCUTIOYLSFZIA-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 110.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.40 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|