C19H18N4O2S — CID 90625555
1-(naphthalen-1-ylmethyl)-3-(4-oxo-5,6,7,8-tetrahydro-[1,3]thiazolo[5,4-c]azepin-2-yl)urea (PubChem CID 90625555) has the molecular formula C19H18N4O2S and a molecular weight of 366.45 g/mol. Its IUPAC name is 1-(naphthalen-1-ylmethyl)-3-(4-oxo-5,6,7,8-tetrahydro-[1,3]thiazolo[5,4-c]azepin-2-yl)urea.
| Compound Name | 1-(naphthalen-1-ylmethyl)-3-(4-oxo-5,6,7,8-tetrahydro-[1,3]thiazolo[5,4-c]azepin-2-yl)urea |
|---|---|
| PubChem CID | 90625555 |
| Molecular Formula | C19H18N4O2S |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 1-(naphthalen-1-ylmethyl)-3-(4-oxo-5,6,7,8-tetrahydro-[1,3]thiazolo[5,4-c]azepin-2-yl)urea |
| SMILES | O=C(NCc1cccc2ccccc12)Nc1nc2c(s1)C(=O)NCCC2 |
| InChI | InChI=1S/C19H18N4O2S/c24-17-16-15(9-4-10-20-17)22-19(26-16)23-18(25)21-11-13-7-3-6-12-5-1-2-8-14(12)13/h1-3,5-8H,4,9-11H2,(H,20,24)(H2,21,22,23,25) |
| InChIKey | XMUKMZPERMATLQ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |