C17H20N4O2S — CID 90625563
1-(4-oxo-5,6,7,8-tetrahydro-[1,3]thiazolo[5,4-c]azepin-2-yl)-3-(3-phenylpropyl)urea (PubChem CID 90625563) has the molecular formula C17H20N4O2S and a molecular weight of 344.44 g/mol. Its IUPAC name is 1-(4-oxo-5,6,7,8-tetrahydro-[1,3]thiazolo[5,4-c]azepin-2-yl)-3-(3-phenylpropyl)urea.
| Compound Name | 1-(4-oxo-5,6,7,8-tetrahydro-[1,3]thiazolo[5,4-c]azepin-2-yl)-3-(3-phenylpropyl)urea |
|---|---|
| PubChem CID | 90625563 |
| Molecular Formula | C17H20N4O2S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 1-(4-oxo-5,6,7,8-tetrahydro-[1,3]thiazolo[5,4-c]azepin-2-yl)-3-(3-phenylpropyl)urea |
| SMILES | O=C(NCCCc1ccccc1)Nc1nc2c(s1)C(=O)NCCC2 |
| InChI | InChI=1S/C17H20N4O2S/c22-15-14-13(9-5-10-18-15)20-17(24-14)21-16(23)19-11-4-8-12-6-2-1-3-7-12/h1-3,6-7H,4-5,8-11H2,(H,18,22)(H2,19,20,21,23) |
| InChIKey | YJSFEEYCZJHQCX-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|