C24H20N2OS — CID 90627855
4-(4-methylphenyl)-N-[(5-thiophen-3-yl-3-pyridinyl)methyl]benzamide (PubChem CID 90627855) has the molecular formula C24H20N2OS and a molecular weight of 384.50 g/mol. Its IUPAC name is 4-(4-methylphenyl)-N-[(5-thiophen-3-yl-3-pyridinyl)methyl]benzamide.
| Compound Name | 4-(4-methylphenyl)-N-[(5-thiophen-3-yl-3-pyridinyl)methyl]benzamide |
|---|---|
| PubChem CID | 90627855 |
| Molecular Formula | C24H20N2OS |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | 4-(4-methylphenyl)-N-[(5-thiophen-3-yl-3-pyridinyl)methyl]benzamide |
| SMILES | Cc1ccc(-c2ccc(C(=O)NCc3cncc(-c4ccsc4)c3)cc2)cc1 |
| InChI | InChI=1S/C24H20N2OS/c1-17-2-4-19(5-3-17)20-6-8-21(9-7-20)24(27)26-14-18-12-23(15-25-13-18)22-10-11-28-16-22/h2-13,15-16H,14H2,1H3,(H,26,27) |
| InChIKey | ZWFCNLKTCJRFLS-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |