C21H25N3OS — CID 90628030
1-(1-adamantyl)-3-[(5-thiophen-3-yl-3-pyridinyl)methyl]urea (PubChem CID 90628030) has the molecular formula C21H25N3OS and a molecular weight of 367.52 g/mol. Its IUPAC name is 1-(1-adamantyl)-3-[(5-thiophen-3-yl-3-pyridinyl)methyl]urea.
| Compound Name | 1-(1-adamantyl)-3-[(5-thiophen-3-yl-3-pyridinyl)methyl]urea |
|---|---|
| PubChem CID | 90628030 |
| Molecular Formula | C21H25N3OS |
| Molecular Weight | 367.52 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | 1-(1-adamantyl)-3-[(5-thiophen-3-yl-3-pyridinyl)methyl]urea |
| SMILES | O=C(NCc1cncc(-c2ccsc2)c1)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C21H25N3OS/c25-20(24-21-7-14-3-15(8-21)5-16(4-14)9-21)23-11-17-6-19(12-22-10-17)18-1-2-26-13-18/h1-2,6,10,12-16H,3-5,7-9,11H2,(H2,23,24,25) |
| InChIKey | JWKHAZOCYPXMKY-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.52 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |