C20H20N4O2S — CID 90633137
3-pyridin-2-yloxy-N-[[1-(1,3-thiazol-2-yl)pyrrolidin-2-yl]methyl]benzamide (PubChem CID 90633137) has the molecular formula C20H20N4O2S and a molecular weight of 380.47 g/mol. Its IUPAC name is 3-pyridin-2-yloxy-N-[[1-(1,3-thiazol-2-yl)pyrrolidin-2-yl]methyl]benzamide.
| Compound Name | 3-pyridin-2-yloxy-N-[[1-(1,3-thiazol-2-yl)pyrrolidin-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 90633137 |
| Molecular Formula | C20H20N4O2S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | 3-pyridin-2-yloxy-N-[[1-(1,3-thiazol-2-yl)pyrrolidin-2-yl]methyl]benzamide |
| SMILES | O=C(NCC1CCCN1c1nccs1)c1cccc(Oc2ccccn2)c1 |
| InChI | InChI=1S/C20H20N4O2S/c25-19(23-14-16-6-4-11-24(16)20-22-10-12-27-20)15-5-3-7-17(13-15)26-18-8-1-2-9-21-18/h1-3,5,7-10,12-13,16H,4,6,11,14H2,(H,23,25) |
| InChIKey | PCQJAAUVGPHPCM-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |