C14H23N5O3 — CID 90639804
3-[6-(dimethylamino)pyridazin-3-yl]oxy-N-(2-methoxyethyl)pyrrolidine-1-carboxamide (PubChem CID 90639804) has the molecular formula C14H23N5O3 and a molecular weight of 309.37 g/mol. Its IUPAC name is 3-[6-(dimethylamino)pyridazin-3-yl]oxy-N-(2-methoxyethyl)pyrrolidine-1-carboxamide.
| Compound Name | 3-[6-(dimethylamino)pyridazin-3-yl]oxy-N-(2-methoxyethyl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 90639804 |
| Molecular Formula | C14H23N5O3 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.18 |
| IUPAC Name | 3-[6-(dimethylamino)pyridazin-3-yl]oxy-N-(2-methoxyethyl)pyrrolidine-1-carboxamide |
| SMILES | COCCNC(=O)N1CCC(Oc2ccc(N(C)C)nn2)C1 |
| InChI | InChI=1S/C14H23N5O3/c1-18(2)12-4-5-13(17-16-12)22-11-6-8-19(10-11)14(20)15-7-9-21-3/h4-5,11H,6-10H2,1-3H3,(H,15,20) |
| InChIKey | PNAXRJVZIVZUPM-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|