C15H23N5O3 — CID 100637237
[(3R)-3-[6-(dimethylamino)pyridazin-3-yl]oxypyrrolidin-1-yl]-morpholin-4-ylmethanone (PubChem CID 100637237) has the molecular formula C15H23N5O3 and a molecular weight of 321.38 g/mol. Its IUPAC name is [(3R)-3-[6-(dimethylamino)pyridazin-3-yl]oxypyrrolidin-1-yl]-morpholin-4-ylmethanone.
| Compound Name | [(3R)-3-[6-(dimethylamino)pyridazin-3-yl]oxypyrrolidin-1-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 100637237 |
| Molecular Formula | C15H23N5O3 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | [(3R)-3-[6-(dimethylamino)pyridazin-3-yl]oxypyrrolidin-1-yl]-morpholin-4-ylmethanone |
| SMILES | CN(C)c1ccc(O[C@@H]2CCN(C(=O)N3CCOCC3)C2)nn1 |
| InChI | InChI=1S/C15H23N5O3/c1-18(2)13-3-4-14(17-16-13)23-12-5-6-20(11-12)15(21)19-7-9-22-10-8-19/h3-4,12H,5-11H2,1-2H3/t12-/m1/s1 |
| InChIKey | YKIJEXHLZRKCAU-GFCCVEGCSA-N |
| XLogP | 0.45 |
| TPSA | 71.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |