C19H26N4O — CID 90640111
N-[4-(diethylamino)-2-methylphenyl]-4,5,6,7-tetrahydro-3H-benzimidazole-5-carboxamide (PubChem CID 90640111) has the molecular formula C19H26N4O and a molecular weight of 326.44 g/mol. Its IUPAC name is N-[4-(diethylamino)-2-methylphenyl]-4,5,6,7-tetrahydro-3H-benzimidazole-5-carboxamide.
| Compound Name | N-[4-(diethylamino)-2-methylphenyl]-4,5,6,7-tetrahydro-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 90640111 |
| Molecular Formula | C19H26N4O |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | N-[4-(diethylamino)-2-methylphenyl]-4,5,6,7-tetrahydro-3H-benzimidazole-5-carboxamide |
| SMILES | CCN(CC)c1ccc(NC(=O)C2CCc3nc[nH]c3C2)c(C)c1 |
| InChI | InChI=1S/C19H26N4O/c1-4-23(5-2)15-7-9-16(13(3)10-15)22-19(24)14-6-8-17-18(11-14)21-12-20-17/h7,9-10,12,14H,4-6,8,11H2,1-3H3,(H,20,21)(H,22,24) |
| InChIKey | DLDJTQAPBKPXDY-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|