C20H21N3O6 — CID 70055740
N-(2-acetylphenyl)-4,5,6,7-tetrahydro-3H-benzimidazole-5-carboxamide;but-2-enedioic acid (PubChem CID 70055740) has the molecular formula C20H21N3O6 and a molecular weight of 399.40 g/mol. Its IUPAC name is N-(2-acetylphenyl)-4,5,6,7-tetrahydro-3H-benzimidazole-5-carboxamide;but-2-enedioic acid.
| Compound Name | N-(2-acetylphenyl)-4,5,6,7-tetrahydro-3H-benzimidazole-5-carboxamide;but-2-enedioic acid |
|---|---|
| PubChem CID | 70055740 |
| Molecular Formula | C20H21N3O6 |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | N-(2-acetylphenyl)-4,5,6,7-tetrahydro-3H-benzimidazole-5-carboxamide;but-2-enedioic acid |
| SMILES | CC(=O)c1ccccc1NC(=O)C1CCc2nc[nH]c2C1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C16H17N3O2.C4H4O4/c1-10(20)12-4-2-3-5-13(12)19-16(21)11-6-7-14-15(8-11)18-9-17-14;5-3(6)1-2-4(7)8/h2-5,9,11H,6-8H2,1H3,(H,17,18)(H,19,21);1-2H,(H,5,6)(H,7,8) |
| InChIKey | HOVXUZMJXKIFAX-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 149.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|