C22H23N3O5 — CID 90641579
3-[3-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)methyl]piperidine-1-carbonyl]-8-methoxychromen-2-one (PubChem CID 90641579) has the molecular formula C22H23N3O5 and a molecular weight of 409.44 g/mol. Its IUPAC name is 3-[3-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)methyl]piperidine-1-carbonyl]-8-methoxychromen-2-one.
| Compound Name | 3-[3-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)methyl]piperidine-1-carbonyl]-8-methoxychromen-2-one |
|---|---|
| PubChem CID | 90641579 |
| Molecular Formula | C22H23N3O5 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | 3-[3-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)methyl]piperidine-1-carbonyl]-8-methoxychromen-2-one |
| SMILES | COc1cccc2cc(C(=O)N3CCCC(Cc4nc(C5CC5)no4)C3)c(=O)oc12 |
| InChI | InChI=1S/C22H23N3O5/c1-28-17-6-2-5-15-11-16(22(27)29-19(15)17)21(26)25-9-3-4-13(12-25)10-18-23-20(24-30-18)14-7-8-14/h2,5-6,11,13-14H,3-4,7-10,12H2,1H3 |
| InChIKey | YVNGVCBVYCLPBL-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 98.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|