C18H12Cl2FNO3 — CID 90642991
methyl (E)-2-cyano-3-[3,5-dichloro-4-[(2-fluorophenyl)methoxy]phenyl]prop-2-enoate (PubChem CID 90642991) has the molecular formula C18H12Cl2FNO3 and a molecular weight of 380.20 g/mol. Its IUPAC name is methyl (E)-2-cyano-3-[3,5-dichloro-4-[(2-fluorophenyl)methoxy]phenyl]prop-2-enoate.
| Compound Name | methyl (E)-2-cyano-3-[3,5-dichloro-4-[(2-fluorophenyl)methoxy]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 90642991 |
| Molecular Formula | C18H12Cl2FNO3 |
| Molecular Weight | 380.20 g/mol |
| Exact Mass | 379.02 |
| IUPAC Name | methyl (E)-2-cyano-3-[3,5-dichloro-4-[(2-fluorophenyl)methoxy]phenyl]prop-2-enoate |
| SMILES | COC(=O)/C(C#N)=C/c1cc(Cl)c(OCc2ccccc2F)c(Cl)c1 |
| InChI | InChI=1S/C18H12Cl2FNO3/c1-24-18(23)13(9-22)6-11-7-14(19)17(15(20)8-11)25-10-12-4-2-3-5-16(12)21/h2-8H,10H2,1H3/b13-6+ |
| InChIKey | BEWAXSHYLWIORX-AWNIVKPZSA-N |
| XLogP | 4.79 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.20 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|