C18H17NO4 — CID 90643726
[(E)-(3,6-dioxo-4-propan-2-ylcyclohexa-1,4-dien-1-yl)methylideneamino] 2-methylbenzoate (PubChem CID 90643726) has the molecular formula C18H17NO4 and a molecular weight of 311.34 g/mol. Its IUPAC name is [(E)-(3,6-dioxo-4-propan-2-ylcyclohexa-1,4-dien-1-yl)methylideneamino] 2-methylbenzoate.
| Compound Name | [(E)-(3,6-dioxo-4-propan-2-ylcyclohexa-1,4-dien-1-yl)methylideneamino] 2-methylbenzoate |
|---|---|
| PubChem CID | 90643726 |
| Molecular Formula | C18H17NO4 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | [(E)-(3,6-dioxo-4-propan-2-ylcyclohexa-1,4-dien-1-yl)methylideneamino] 2-methylbenzoate |
| SMILES | Cc1ccccc1C(=O)O/N=C/C1=CC(=O)C(C(C)C)=CC1=O |
| InChI | InChI=1S/C18H17NO4/c1-11(2)15-9-16(20)13(8-17(15)21)10-19-23-18(22)14-7-5-4-6-12(14)3/h4-11H,1-3H3/b19-10+ |
| InChIKey | KRHMAJOTJVOLBI-VXLYETTFSA-N |
| XLogP | 2.80 |
| TPSA | 72.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|