C17H27N3 — CID 90644921
7,8,9,10-tetramethyl-3-azapentacyclo[7.2.1.15,8.01,5.07,10]tridecane-3-carboximidamide (PubChem CID 90644921) has the molecular formula C17H27N3 and a molecular weight of 273.42 g/mol. Its IUPAC name is 7,8,9,10-tetramethyl-3-azapentacyclo[7.2.1.15,8.01,5.07,10]tridecane-3-carboximidamide.
| Compound Name | 7,8,9,10-tetramethyl-3-azapentacyclo[7.2.1.15,8.01,5.07,10]tridecane-3-carboximidamide |
|---|---|
| PubChem CID | 90644921 |
| Molecular Formula | C17H27N3 |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.22 |
| IUPAC Name | 7,8,9,10-tetramethyl-3-azapentacyclo[7.2.1.15,8.01,5.07,10]tridecane-3-carboximidamide |
| SMILES | [H]/N=C(\N)N1CC23CC4(C)C(C)(C2)C2(C)CC3(C1)CC42C |
| InChI | InChI=1S/C17H27N3/c1-12-5-16-6-13(12,2)15(4)8-17(16,7-14(12,15)3)10-20(9-16)11(18)19/h5-10H2,1-4H3,(H3,18,19) |
| InChIKey | FOBQGDGHXQVYIG-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|