C19H17NO5 — CID 90647994
5-[[[2-(5-oxo-2-phenylcyclopenten-1-yl)acetyl]amino]methyl]furan-2-carboxylic acid (PubChem CID 90647994) has the molecular formula C19H17NO5 and a molecular weight of 339.35 g/mol. Its IUPAC name is 5-[[[2-(5-oxo-2-phenylcyclopenten-1-yl)acetyl]amino]methyl]furan-2-carboxylic acid.
| Compound Name | 5-[[[2-(5-oxo-2-phenylcyclopenten-1-yl)acetyl]amino]methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 90647994 |
| Molecular Formula | C19H17NO5 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | 5-[[[2-(5-oxo-2-phenylcyclopenten-1-yl)acetyl]amino]methyl]furan-2-carboxylic acid |
| SMILES | O=C(CC1=C(c2ccccc2)CCC1=O)NCc1ccc(C(=O)O)o1 |
| InChI | InChI=1S/C19H17NO5/c21-16-8-7-14(12-4-2-1-3-5-12)15(16)10-18(22)20-11-13-6-9-17(25-13)19(23)24/h1-6,9H,7-8,10-11H2,(H,20,22)(H,23,24) |
| InChIKey | WCNSAWPXEBTEHX-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |