C19H26N4O2 — CID 90648778
1-[3-(5-methyl-1H-1,2,4-triazol-3-yl)piperidin-1-yl]-4-phenylmethoxybutan-1-one (PubChem CID 90648778) has the molecular formula C19H26N4O2 and a molecular weight of 342.44 g/mol. Its IUPAC name is 1-[3-(5-methyl-1H-1,2,4-triazol-3-yl)piperidin-1-yl]-4-phenylmethoxybutan-1-one.
| Compound Name | 1-[3-(5-methyl-1H-1,2,4-triazol-3-yl)piperidin-1-yl]-4-phenylmethoxybutan-1-one |
|---|---|
| PubChem CID | 90648778 |
| Molecular Formula | C19H26N4O2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | 1-[3-(5-methyl-1H-1,2,4-triazol-3-yl)piperidin-1-yl]-4-phenylmethoxybutan-1-one |
| SMILES | Cc1nc(C2CCCN(C(=O)CCCOCc3ccccc3)C2)n[nH]1 |
| InChI | InChI=1S/C19H26N4O2/c1-15-20-19(22-21-15)17-9-5-11-23(13-17)18(24)10-6-12-25-14-16-7-3-2-4-8-16/h2-4,7-8,17H,5-6,9-14H2,1H3,(H,20,21,22) |
| InChIKey | BALOJUKDJAUMSR-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|