C15H17N5OS — CID 90650982
2-(benzotriazol-2-yl)-N-[3-(4-methyl-1,3-thiazol-5-yl)propyl]acetamide (PubChem CID 90650982) has the molecular formula C15H17N5OS and a molecular weight of 315.40 g/mol. Its IUPAC name is 2-(benzotriazol-2-yl)-N-[3-(4-methyl-1,3-thiazol-5-yl)propyl]acetamide.
| Compound Name | 2-(benzotriazol-2-yl)-N-[3-(4-methyl-1,3-thiazol-5-yl)propyl]acetamide |
|---|---|
| PubChem CID | 90650982 |
| Molecular Formula | C15H17N5OS |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | 2-(benzotriazol-2-yl)-N-[3-(4-methyl-1,3-thiazol-5-yl)propyl]acetamide |
| SMILES | Cc1ncsc1CCCNC(=O)Cn1nc2ccccc2n1 |
| InChI | InChI=1S/C15H17N5OS/c1-11-14(22-10-17-11)7-4-8-16-15(21)9-20-18-12-5-2-3-6-13(12)19-20/h2-3,5-6,10H,4,7-9H2,1H3,(H,16,21) |
| InChIKey | YSOVRLRXTJTIDV-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|