C17H24N6OS — CID 135089946
N-[3-(4-methyl-1,3-thiazol-5-yl)propyl]-2-(4-pyrimidin-2-ylpiperazin-1-yl)acetamide (PubChem CID 135089946) has the molecular formula C17H24N6OS and a molecular weight of 360.49 g/mol. Its IUPAC name is N-[3-(4-methyl-1,3-thiazol-5-yl)propyl]-2-(4-pyrimidin-2-ylpiperazin-1-yl)acetamide.
| Compound Name | N-[3-(4-methyl-1,3-thiazol-5-yl)propyl]-2-(4-pyrimidin-2-ylpiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 135089946 |
| Molecular Formula | C17H24N6OS |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | N-[3-(4-methyl-1,3-thiazol-5-yl)propyl]-2-(4-pyrimidin-2-ylpiperazin-1-yl)acetamide |
| SMILES | Cc1ncsc1CCCNC(=O)CN1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C17H24N6OS/c1-14-15(25-13-21-14)4-2-5-18-16(24)12-22-8-10-23(11-9-22)17-19-6-3-7-20-17/h3,6-7,13H,2,4-5,8-12H2,1H3,(H,18,24) |
| InChIKey | OGYLCJNDAHLQMB-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|