About 1-methyl-N-(2,2,2-trifluoroethyl)pyridin-2-imine;hydrobromide
1-methyl-N-(2,2,2-trifluoroethyl)pyridin-2-imine;hydrobromide (PubChem CID 90654286) has the molecular formula C8H10BrF3N2
and a molecular weight of 271.08 g/mol. Its IUPAC name is 1-methyl-N-(2,2,2-trifluoroethyl)pyridin-2-imine;hydrobromide.
Molecular Properties
| Compound Name | 1-methyl-N-(2,2,2-trifluoroethyl)pyridin-2-imine;hydrobromide |
| PubChem CID | 90654286 |
| Molecular Formula | C8H10BrF3N2 |
| Molecular Weight | 271.08 g/mol |
| Exact Mass | 270.00 |
| IUPAC Name | 1-methyl-N-(2,2,2-trifluoroethyl)pyridin-2-imine;hydrobromide |
| SMILES | Br.Cn1cccc/c1=N\CC(F)(F)F |
| InChI | InChI=1S/C8H9F3N2.BrH/c1-13-5-3-2-4-7(13)12-6-8(9,10)11;/h2-5H,6H2,1H3;1H/b12-7+; |
| InChIKey | JYFLTWPQGNTBQV-RRAJOLSVSA-N |
| XLogP | 2.07 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.08 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-methyl-N-(2,2,2-trifluoroethyl)pyridin-2-imine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-N-(2,2,2-trifluoroethyl)pyridin-2-imine;hydrobromide?
The IUPAC name of 1-methyl-N-(2,2,2-trifluoroethyl)pyridin-2-imine;hydrobromide (CID 90654286) is 1-methyl-N-(2,2,2-trifluoroethyl)pyridin-2-imine;hydrobromide.
What is the SMILES notation for 1-methyl-N-(2,2,2-trifluoroethyl)pyridin-2-imine;hydrobromide?
The canonical SMILES for 1-methyl-N-(2,2,2-trifluoroethyl)pyridin-2-imine;hydrobromide is Br.Cn1cccc/c1=N\CC(F)(F)F.
What is the InChIKey of 1-methyl-N-(2,2,2-trifluoroethyl)pyridin-2-imine;hydrobromide?
The InChIKey is JYFLTWPQGNTBQV-RRAJOLSVSA-N. The full InChI is InChI=1S/C8H9F3N2.BrH/c1-13-5-3-2-4-7(13)12-6-8(9,10)11;/h2-5H,6H2,1H3;1H/b12-7+;.
What are the key properties of 1-methyl-N-(2,2,2-trifluoroethyl)pyridin-2-imine;hydrobromide?
1-methyl-N-(2,2,2-trifluoroethyl)pyridin-2-imine;hydrobromide has a molecular weight of 271.08 g/mol, XLogP of 2.07, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-N-(2,2,2-trifluoroethyl)pyridin-2-imine;hydrobromide is sourced from PubChem (CID 90654286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).