C32H50N2O3 — CID 90656316
N,N-dibutyl-6-[4-[(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl)methyl]phenoxy]hexan-1-amine (PubChem CID 90656316) has the molecular formula C32H50N2O3 and a molecular weight of 510.76 g/mol. Its IUPAC name is N,N-dibutyl-6-[4-[(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl)methyl]phenoxy]hexan-1-amine.
| Compound Name | N,N-dibutyl-6-[4-[(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl)methyl]phenoxy]hexan-1-amine |
|---|---|
| PubChem CID | 90656316 |
| Molecular Formula | C32H50N2O3 |
| Molecular Weight | 510.76 g/mol |
| Exact Mass | 510.38 |
| IUPAC Name | N,N-dibutyl-6-[4-[(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl)methyl]phenoxy]hexan-1-amine |
| SMILES | CCCCN(CCCC)CCCCCCOc1ccc(CC2NCCc3cc(OC)c(OC)cc32)cc1 |
| InChI | InChI=1S/C32H50N2O3/c1-5-7-19-34(20-8-6-2)21-11-9-10-12-22-37-28-15-13-26(14-16-28)23-30-29-25-32(36-4)31(35-3)24-27(29)17-18-33-30/h13-16,24-25,30,33H,5-12,17-23H2,1-4H3 |
| InChIKey | FQFUKTCPJFQACE-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.76 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|