C30H39N7O14S2 — CID 90661568
2-(6-aminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol;bis(methyl 4-(ethoxycarbonylamino)benzenesulfonate) (PubChem CID 90661568) has the molecular formula C30H39N7O14S2 and a molecular weight of 785.81 g/mol. Its IUPAC name is 2-(6-aminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol;bis(methyl 4-(ethoxycarbonylamino)benzenesulfonate).
| Compound Name | 2-(6-aminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol;bis(methyl 4-(ethoxycarbonylamino)benzenesulfonate) |
|---|---|
| PubChem CID | 90661568 |
| Molecular Formula | C30H39N7O14S2 |
| Molecular Weight | 785.81 g/mol |
| Exact Mass | 785.20 |
| IUPAC Name | 2-(6-aminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol;bis(methyl 4-(ethoxycarbonylamino)benzenesulfonate) |
| SMILES | CCOC(=O)Nc1ccc(S(=O)(=O)OC)cc1.CCOC(=O)Nc1ccc(S(=O)(=O)OC)cc1.Nc1ncnc2c1ncn2C1OC(CO)C(O)C1O |
| InChI | InChI=1S/C10H13N5O4.2C10H13NO5S/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(18)6(17)4(1-16)19-10;2*1-3-16-10(12)11-8-4-6-9(7-5-8)17(13,14)15-2/h2-4,6-7,10,16-18H,1H2,(H2,11,12,13);2*4-7H,3H2,1-2H3,(H,11,12) |
| InChIKey | XXVLDVJZYROOGX-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 302.94 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.81 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|