C20H32O3 — CID 90662535
4-hydroxy-3,5-dimethyl-6-[(E,4R,6R,8R)-4,6,8-trimethyldec-2-en-2-yl]pyran-2-one (PubChem CID 90662535) has the molecular formula C20H32O3 and a molecular weight of 320.47 g/mol. Its IUPAC name is 4-hydroxy-3,5-dimethyl-6-[(E,4R,6R,8R)-4,6,8-trimethyldec-2-en-2-yl]pyran-2-one.
| Compound Name | 4-hydroxy-3,5-dimethyl-6-[(E,4R,6R,8R)-4,6,8-trimethyldec-2-en-2-yl]pyran-2-one |
|---|---|
| PubChem CID | 90662535 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | 4-hydroxy-3,5-dimethyl-6-[(E,4R,6R,8R)-4,6,8-trimethyldec-2-en-2-yl]pyran-2-one |
| SMILES | CC[C@@H](C)C[C@@H](C)C[C@@H](C)/C=C(\C)c1oc(=O)c(C)c(O)c1C |
| InChI | InChI=1S/C20H32O3/c1-8-12(2)9-13(3)10-14(4)11-15(5)19-16(6)18(21)17(7)20(22)23-19/h11-14,21H,8-10H2,1-7H3/b15-11+/t12-,13-,14-/m1/s1 |
| InChIKey | ZKTRNIAGKXVOQI-OXDJQUEGSA-N |
| XLogP | 5.46 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |