C17H19N2O10P — CID 90663251
[(2R,3S,5R)-5-[5-(4,5-dimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)-2,4-dioxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 90663251) has the molecular formula C17H19N2O10P and a molecular weight of 442.32 g/mol. Its IUPAC name is [(2R,3S,5R)-5-[5-(4,5-dimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)-2,4-dioxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3S,5R)-5-[5-(4,5-dimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)-2,4-dioxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 90663251 |
| Molecular Formula | C17H19N2O10P |
| Molecular Weight | 442.32 g/mol |
| Exact Mass | 442.08 |
| IUPAC Name | [(2R,3S,5R)-5-[5-(4,5-dimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)-2,4-dioxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | CC1=C(C)C(=O)C(c2cn([C@H]3C[C@H](O)[C@@H](COP(=O)(O)O)O3)c(=O)[nH]c2=O)=CC1=O |
| InChI | InChI=1S/C17H19N2O10P/c1-7-8(2)15(22)9(3-11(7)20)10-5-19(17(24)18-16(10)23)14-4-12(21)13(29-14)6-28-30(25,26)27/h3,5,12-14,21H,4,6H2,1-2H3,(H,18,23,24)(H2,25,26,27)/t12-,13+,14+/m0/s1 |
| InChIKey | POWXBBNMDWEACG-BFHYXJOUSA-N |
| XLogP | -0.83 |
| TPSA | 185.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.32 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|