C32H31F2N7O6 — CID 90663378
4-[[[2-amino-9-[(2R,4R,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]-bis(4-methoxyphenyl)methyl]benzamide (PubChem CID 90663378) has the molecular formula C32H31F2N7O6 and a molecular weight of 647.64 g/mol. Its IUPAC name is 4-[[[2-amino-9-[(2R,4R,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]-bis(4-methoxyphenyl)methyl]benzamide.
| Compound Name | 4-[[[2-amino-9-[(2R,4R,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]-bis(4-methoxyphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 90663378 |
| Molecular Formula | C32H31F2N7O6 |
| Molecular Weight | 647.64 g/mol |
| Exact Mass | 647.23 |
| IUPAC Name | 4-[[[2-amino-9-[(2R,4R,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]-bis(4-methoxyphenyl)methyl]benzamide |
| SMILES | COc1ccc(C(Nc2nc(N)nc3c2ncn3[C@@H]2O[C@H](CO)[C@@H](O)C2(F)F)(c2ccc(OC)cc2)c2ccc(C(N)=O)cc2)cc1 |
| InChI | InChI=1S/C32H31F2N7O6/c1-45-21-11-7-19(8-12-21)31(20-9-13-22(46-2)14-10-20,18-5-3-17(4-6-18)26(35)44)40-27-24-28(39-30(36)38-27)41(16-37-24)29-32(33,34)25(43)23(15-42)47-29/h3-14,16,23,25,29,42-43H,15H2,1-2H3,(H2,35,44)(H3,36,38,39,40)/t23-,25-,29-/m1/s1 |
| InChIKey | XOFYOKVXGAHJOL-FLFAWLEMSA-N |
| XLogP | 2.81 |
| TPSA | 192.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.64 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|