C16H22Cl2IN3O2 — CID 90664667
N-[2-(diethylamino)ethyl]-6-(125I)iodo-4-oxo-1H-quinoline-3-carboxamide;dihydrochloride (PubChem CID 90664667) has the molecular formula C16H22Cl2IN3O2 and a molecular weight of 484.18 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-6-(125I)iodo-4-oxo-1H-quinoline-3-carboxamide;dihydrochloride.
| Compound Name | N-[2-(diethylamino)ethyl]-6-(125I)iodo-4-oxo-1H-quinoline-3-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 90664667 |
| Molecular Formula | C16H22Cl2IN3O2 |
| Molecular Weight | 484.18 g/mol |
| Exact Mass | 483.01 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-6-(125I)iodo-4-oxo-1H-quinoline-3-carboxamide;dihydrochloride |
| SMILES | CCN(CC)CCNC(=O)c1c[nH]c2ccc([125I])cc2c1=O.Cl.Cl |
| InChI | InChI=1S/C16H20IN3O2.2ClH/c1-3-20(4-2)8-7-18-16(22)13-10-19-14-6-5-11(17)9-12(14)15(13)21;;/h5-6,9-10H,3-4,7-8H2,1-2H3,(H,18,22)(H,19,21);2*1H/i17-2;; |
| InChIKey | OMJWBKGKGQHZNG-GDGRXHIBSA-N |
| XLogP | 3.05 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.18 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|