C24H18ClFO2 — CID 90666657
(1E,4E)-1-(4-chlorophenyl)-5-[2-[(4-fluorophenyl)methoxy]phenyl]penta-1,4-dien-3-one (PubChem CID 90666657) has the molecular formula C24H18ClFO2 and a molecular weight of 392.86 g/mol. Its IUPAC name is (1E,4E)-1-(4-chlorophenyl)-5-[2-[(4-fluorophenyl)methoxy]phenyl]penta-1,4-dien-3-one.
| Compound Name | (1E,4E)-1-(4-chlorophenyl)-5-[2-[(4-fluorophenyl)methoxy]phenyl]penta-1,4-dien-3-one |
|---|---|
| PubChem CID | 90666657 |
| Molecular Formula | C24H18ClFO2 |
| Molecular Weight | 392.86 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | (1E,4E)-1-(4-chlorophenyl)-5-[2-[(4-fluorophenyl)methoxy]phenyl]penta-1,4-dien-3-one |
| SMILES | O=C(/C=C/c1ccc(Cl)cc1)/C=C/c1ccccc1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C24H18ClFO2/c25-21-11-5-18(6-12-21)9-15-23(27)16-10-20-3-1-2-4-24(20)28-17-19-7-13-22(26)14-8-19/h1-16H,17H2/b15-9+,16-10+ |
| InChIKey | OUACGEOUVBNSDV-KAVGSWPWSA-N |
| XLogP | 6.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.86 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|