C23H24Cl2N2O — CID 90669333
1-[2,6-bis(4-chlorophenyl)-4-pyridinyl]-2-(diethylamino)ethanol (PubChem CID 90669333) has the molecular formula C23H24Cl2N2O and a molecular weight of 415.36 g/mol. Its IUPAC name is 1-[2,6-bis(4-chlorophenyl)-4-pyridinyl]-2-(diethylamino)ethanol.
| Compound Name | 1-[2,6-bis(4-chlorophenyl)-4-pyridinyl]-2-(diethylamino)ethanol |
|---|---|
| PubChem CID | 90669333 |
| Molecular Formula | C23H24Cl2N2O |
| Molecular Weight | 415.36 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | 1-[2,6-bis(4-chlorophenyl)-4-pyridinyl]-2-(diethylamino)ethanol |
| SMILES | CCN(CC)CC(O)c1cc(-c2ccc(Cl)cc2)nc(-c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C23H24Cl2N2O/c1-3-27(4-2)15-23(28)18-13-21(16-5-9-19(24)10-6-16)26-22(14-18)17-7-11-20(25)12-8-17/h5-14,23,28H,3-4,15H2,1-2H3 |
| InChIKey | XCPAQQVJFUBFMM-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.36 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |