C15H9N5S2 — CID 90673810
5,6-diisothiocyanato-1-methyl-2-pyridin-2-ylbenzimidazole (PubChem CID 90673810) has the molecular formula C15H9N5S2 and a molecular weight of 323.41 g/mol. Its IUPAC name is 5,6-diisothiocyanato-1-methyl-2-pyridin-2-ylbenzimidazole.
| Compound Name | 5,6-diisothiocyanato-1-methyl-2-pyridin-2-ylbenzimidazole |
|---|---|
| PubChem CID | 90673810 |
| Molecular Formula | C15H9N5S2 |
| Molecular Weight | 323.41 g/mol |
| Exact Mass | 323.03 |
| IUPAC Name | 5,6-diisothiocyanato-1-methyl-2-pyridin-2-ylbenzimidazole |
| SMILES | Cn1c(-c2ccccn2)nc2cc(N=C=S)c(N=C=S)cc21 |
| InChI | InChI=1S/C15H9N5S2/c1-20-14-7-12(18-9-22)11(17-8-21)6-13(14)19-15(20)10-4-2-3-5-16-10/h2-7H,1H3 |
| InChIKey | RHWRALKSFWZDIU-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 55.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.41 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|