C10H18ClN5 — CID 90674680
N,N-dimethyl-6-piperazin-1-ylpyrazin-2-amine;hydrochloride (PubChem CID 90674680) has the molecular formula C10H18ClN5 and a molecular weight of 243.74 g/mol. Its IUPAC name is N,N-dimethyl-6-piperazin-1-ylpyrazin-2-amine;hydrochloride.
| Compound Name | N,N-dimethyl-6-piperazin-1-ylpyrazin-2-amine;hydrochloride |
|---|---|
| PubChem CID | 90674680 |
| Molecular Formula | C10H18ClN5 |
| Molecular Weight | 243.74 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | N,N-dimethyl-6-piperazin-1-ylpyrazin-2-amine;hydrochloride |
| SMILES | CN(C)c1cncc(N2CCNCC2)n1.Cl |
| InChI | InChI=1S/C10H17N5.ClH/c1-14(2)9-7-12-8-10(13-9)15-5-3-11-4-6-15;/h7-8,11H,3-6H2,1-2H3;1H |
| InChIKey | VQARBHYXIKQAIK-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.74 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |