C31H52ClN3 — CID 90674856
N'-[3-[1,5-bis(4-tert-butylphenyl)pentan-3-ylamino]propyl]propane-1,3-diamine;hydrochloride (PubChem CID 90674856) has the molecular formula C31H52ClN3 and a molecular weight of 502.23 g/mol. Its IUPAC name is N'-[3-[1,5-bis(4-tert-butylphenyl)pentan-3-ylamino]propyl]propane-1,3-diamine;hydrochloride.
| Compound Name | N'-[3-[1,5-bis(4-tert-butylphenyl)pentan-3-ylamino]propyl]propane-1,3-diamine;hydrochloride |
|---|---|
| PubChem CID | 90674856 |
| Molecular Formula | C31H52ClN3 |
| Molecular Weight | 502.23 g/mol |
| Exact Mass | 501.38 |
| IUPAC Name | N'-[3-[1,5-bis(4-tert-butylphenyl)pentan-3-ylamino]propyl]propane-1,3-diamine;hydrochloride |
| SMILES | CC(C)(C)c1ccc(CCC(CCc2ccc(C(C)(C)C)cc2)NCCCNCCCN)cc1.Cl |
| InChI | InChI=1S/C31H51N3.ClH/c1-30(2,3)27-15-9-25(10-16-27)13-19-29(34-24-8-23-33-22-7-21-32)20-14-26-11-17-28(18-12-26)31(4,5)6;/h9-12,15-18,29,33-34H,7-8,13-14,19-24,32H2,1-6H3;1H |
| InChIKey | JYLCJJLGZXGEBI-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.23 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|