C26H29ClN4O5S — CID 90675013
N-[3-methoxy-4-[(3-nitroacridin-10-ium-9-yl)amino]phenyl]hexane-1-sulfonamide chloride (PubChem CID 90675013) has the molecular formula C26H29ClN4O5S and a molecular weight of 545.06 g/mol. Its IUPAC name is N-[3-methoxy-4-[(3-nitroacridin-10-ium-9-yl)amino]phenyl]hexane-1-sulfonamide chloride.
| Compound Name | N-[3-methoxy-4-[(3-nitroacridin-10-ium-9-yl)amino]phenyl]hexane-1-sulfonamide chloride |
|---|---|
| PubChem CID | 90675013 |
| Molecular Formula | C26H29ClN4O5S |
| Molecular Weight | 545.06 g/mol |
| Exact Mass | 544.15 |
| IUPAC Name | N-[3-methoxy-4-[(3-nitroacridin-10-ium-9-yl)amino]phenyl]hexane-1-sulfonamide chloride |
| SMILES | CCCCCCS(=O)(=O)Nc1ccc(Nc2c3ccccc3[nH+]c3cc([N+](=O)[O-])ccc23)c(OC)c1.[Cl-] |
| InChI | InChI=1S/C26H28N4O5S.ClH/c1-3-4-5-8-15-36(33,34)29-18-11-14-23(25(16-18)35-2)28-26-20-9-6-7-10-22(20)27-24-17-19(30(31)32)12-13-21(24)26;/h6-7,9-14,16-17,29H,3-5,8,15H2,1-2H3,(H,27,28);1H |
| InChIKey | QAWWCHBWMNJGFI-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 124.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.06 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|