C18H15ClN6O3 — CID 90675958
N-[3-(2-amino-1H-imidazol-3-ium-5-yl)phenyl]-5-nitro-1H-indole-2-carboxamide chloride (PubChem CID 90675958) has the molecular formula C18H15ClN6O3 and a molecular weight of 398.81 g/mol. Its IUPAC name is N-[3-(2-amino-1H-imidazol-3-ium-5-yl)phenyl]-5-nitro-1H-indole-2-carboxamide chloride.
| Compound Name | N-[3-(2-amino-1H-imidazol-3-ium-5-yl)phenyl]-5-nitro-1H-indole-2-carboxamide chloride |
|---|---|
| PubChem CID | 90675958 |
| Molecular Formula | C18H15ClN6O3 |
| Molecular Weight | 398.81 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | N-[3-(2-amino-1H-imidazol-3-ium-5-yl)phenyl]-5-nitro-1H-indole-2-carboxamide chloride |
| SMILES | Nc1[nH]c(-c2cccc(NC(=O)c3cc4cc([N+](=O)[O-])ccc4[nH]3)c2)c[nH+]1.[Cl-] |
| InChI | InChI=1S/C18H14N6O3.ClH/c19-18-20-9-16(23-18)10-2-1-3-12(6-10)21-17(25)15-8-11-7-13(24(26)27)4-5-14(11)22-15;/h1-9,22H,(H,21,25)(H3,19,20,23);1H |
| InChIKey | SQEHZPVUQHJQIO-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 143.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.81 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|