C23H17ClFNO3 — CID 90676097
6-chloro-3-[4-(4-fluorophenoxy)phenyl]-7-methoxy-2-methyl-1H-quinolin-4-one (PubChem CID 90676097) has the molecular formula C23H17ClFNO3 and a molecular weight of 409.84 g/mol. Its IUPAC name is 6-chloro-3-[4-(4-fluorophenoxy)phenyl]-7-methoxy-2-methyl-1H-quinolin-4-one.
| Compound Name | 6-chloro-3-[4-(4-fluorophenoxy)phenyl]-7-methoxy-2-methyl-1H-quinolin-4-one |
|---|---|
| PubChem CID | 90676097 |
| Molecular Formula | C23H17ClFNO3 |
| Molecular Weight | 409.84 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | 6-chloro-3-[4-(4-fluorophenoxy)phenyl]-7-methoxy-2-methyl-1H-quinolin-4-one |
| SMILES | COc1cc2[nH]c(C)c(-c3ccc(Oc4ccc(F)cc4)cc3)c(=O)c2cc1Cl |
| InChI | InChI=1S/C23H17ClFNO3/c1-13-22(23(27)18-11-19(24)21(28-2)12-20(18)26-13)14-3-7-16(8-4-14)29-17-9-5-15(25)6-10-17/h3-12H,1-2H3,(H,26,27) |
| InChIKey | AVKPNFBAISOFRY-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.84 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |